CAS 1269288-39-2 is the registry number for 2-(5-Chloro-1H-benzo(d)imidazol-2-yl)-N-methylethanamine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 10g.
2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;dihydrochloride (CAS 1269288-39-2) is a chemical compound with the molecular formula C10H14Cl3N3 and a molecular weight of 282.6 g/mol. IUPAC name: 2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;dihydrochloride. InChIKey: LLXMNTGVOJFYOB-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3N3 |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;dihydrochloride |
| InChIKey | LLXMNTGVOJFYOB-UHFFFAOYSA-N |
| SMILES | CNCCC1=NC2=C(N1)C=C(C=C2)Cl.Cl.Cl |
Computed by PubChem (NCBI)