CAS 1864058-48-9 is the registry number for (1-(5-Chloro-1H-1,3-benzodiazol-2-yl)ethyl)(methyl)amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;dihydrochloride (CAS 1864058-48-9) is a chemical compound with the molecular formula C10H14Cl3N3 and a molecular weight of 282.6 g/mol. IUPAC name: 1-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;dihydrochloride. InChIKey: XWGZHGYGJMMZGE-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3N3 |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 1-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;dihydrochloride |
| InChIKey | XWGZHGYGJMMZGE-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(N1)C=C(C=C2)Cl)NC.Cl.Cl |
Computed by PubChem (NCBI)