CAS 1784753-85-0 is the registry number for 7-Chloro-4-methyl-4,5-dihydro-3H-benzo[e][1,4]diazepin-2-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-4-methyl-3,5-dihydro-1,4-benzodiazepin-2-amine;dihydrochloride (CAS 1784753-85-0) is a chemical compound with the molecular formula C10H14Cl3N3 and a molecular weight of 282.6 g/mol. IUPAC name: 7-chloro-4-methyl-3,5-dihydro-1,4-benzodiazepin-2-amine;dihydrochloride. InChIKey: KKPDAYSCWYWJMC-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3N3 |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 7-chloro-4-methyl-3,5-dihydro-1,4-benzodiazepin-2-amine;dihydrochloride |
| InChIKey | KKPDAYSCWYWJMC-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C=CC(=C2)Cl)N=C(C1)N.Cl.Cl |
Computed by PubChem (NCBI)