CAS 1375473-13-4 appears in our catalog under these names: 2-(5-Chloro-1-methyl-1h-1,3-benzodiazol-2-yl)ethan-1-amine dihydrochloride, 95%, (2-(5-Chloro-1-methyl-1H-benzimidazol-2-yl)ethyl)amine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 500mg, 1000mg, 2000mg.
2-(5-chloro-1-methylbenzimidazol-2-yl)ethanamine;dihydrochloride (CAS 1375473-13-4) is a chemical compound with the molecular formula C10H14Cl3N3 and a molecular weight of 282.6 g/mol. IUPAC name: 2-(5-chloro-1-methylbenzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: OTTQXARQBMOMRM-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3N3 |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 2-(5-chloro-1-methylbenzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | OTTQXARQBMOMRM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)N=C1CCN.Cl.Cl |
Computed by PubChem (NCBI)