Products 126939-27-3
CAS 126939-27-3 appears in our catalog under these names: Ketotifen Impurity 3(Ketotifen EP Impurity C）, Ketotifen EP Impurity C. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
2-hydroxy-2-(1-methylpiperidin-4-yl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one (CAS 126939-27-3) is a chemical compound with the molecular formula C19H21NO2S and a molecular weight of 327.4 g/mol. IUPAC name: 2-hydroxy-2-(1-methylpiperidin-4-yl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one. InChIKey: LZPRFURMCOCGDP-UHFFFAOYSA-N.
| Molecular formula | C19H21NO2S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 2-hydroxy-2-(1-methylpiperidin-4-yl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| InChIKey | LZPRFURMCOCGDP-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C2(C3=C(C(=O)CC4=CC=CC=C42)SC=C3)O |
Computed by PubChem (NCBI)