CAS 33301-24-5 appears in our catalog under these names: Dosulepin Sulfone, Dosulepin Impurity 6, Dosulepin Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3E)-3-(5,5-dioxo-6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine (CAS 33301-24-5) is a chemical compound with the molecular formula C19H21NO2S and a molecular weight of 327.4 g/mol. IUPAC name: (3E)-3-(5,5-dioxo-6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine. InChIKey: SDAOUNLJPTVJAJ-GZTJUZNOSA-N.
| Molecular formula | C19H21NO2S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (3E)-3-(5,5-dioxo-6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine |
| InChIKey | SDAOUNLJPTVJAJ-GZTJUZNOSA-N |
| SMILES | CN(C)CC/C=C/1\C2=CC=CC=C2CS(=O)(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)