CAS 1425335-34-7 is the registry number for 2'-Tosyl-2',3'-dihydro-1'H-spiro[cyclobutane-1,4'-isoquinoline], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methylphenyl)sulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclobutane] (CAS 1425335-34-7) is a chemical compound with the molecular formula C19H21NO2S and a molecular weight of 327.4 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclobutane]. InChIKey: AQGNKSQHOZLYLH-UHFFFAOYSA-N.
| Molecular formula | C19H21NO2S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclobutane] |
| InChIKey | AQGNKSQHOZLYLH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3=CC=CC=C3C4(C2)CCC4 |
Computed by PubChem (NCBI)