Products 1346601-61-3
CAS 1346601-61-3 is the registry number for N-Methyl 4-Hydroxy Duloxetine. Offered by: TRC. Available pack sizes: 100mg, 10mg.
4-[(1S)-3-(dimethylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol (CAS 1346601-61-3) is a chemical compound with the molecular formula C19H21NO2S and a molecular weight of 327.4 g/mol. IUPAC name: 4-[(1S)-3-(dimethylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol. InChIKey: SBXNRQCJTFEZJD-SFHVURJKSA-N.
| Molecular formula | C19H21NO2S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-[(1S)-3-(dimethylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-ol |
| InChIKey | SBXNRQCJTFEZJD-SFHVURJKSA-N |
| SMILES | CN(C)CC[C@@H](C1=CC=CS1)OC2=CC=C(C3=CC=CC=C32)O |
Computed by PubChem (NCBI)