Products 1269506-02-6

CAS 1269506-02-6 is the registry number for 1-Ethylcyclopentyl 4-vinylbenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1-ethylcyclopentyl) 4-ethenylbenzoate (CAS 1269506-02-6) is a chemical compound with the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. IUPAC name: (1-ethylcyclopentyl) 4-ethenylbenzoate. InChIKey: AHPPTWYGFXFWTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20O2
Molecular weight244.33 g/mol
IUPAC name(1-ethylcyclopentyl) 4-ethenylbenzoate
InChIKeyAHPPTWYGFXFWTJ-UHFFFAOYSA-N
SMILESCCC1(CCCC1)OC(=O)C2=CC=C(C=C2)C=C

Computed by PubChem (NCBI)