Products 1284177-84-9
CAS 1284177-84-9 is the registry number for 1-(6-methoxynaphthalen-2-yl)-2,2-dimethylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-methoxynaphthalen-2-yl)-2,2-dimethylpropan-1-ol (CAS 1284177-84-9) is a chemical compound with the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. IUPAC name: 1-(6-methoxynaphthalen-2-yl)-2,2-dimethylpropan-1-ol. InChIKey: ALQFRQWOHSHTBG-UHFFFAOYSA-N.
| Molecular formula | C16H20O2 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | 1-(6-methoxynaphthalen-2-yl)-2,2-dimethylpropan-1-ol |
| InChIKey | ALQFRQWOHSHTBG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC2=C(C=C1)C=C(C=C2)OC)O |
Computed by PubChem (NCBI)