CAS 58848-22-9 is the registry number for 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalene-2,3-dicarbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2,3-dicarbaldehyde (CAS 58848-22-9) is a chemical compound with the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2,3-dicarbaldehyde. InChIKey: SDHWJTCAAMPHCM-UHFFFAOYSA-N.
| Molecular formula | C16H20O2 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2,3-dicarbaldehyde |
| InChIKey | SDHWJTCAAMPHCM-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C(C(=C2)C=O)C=O)(C)C)C |
Computed by PubChem (NCBI)