Products 1443306-65-7
CAS 1443306-65-7 is the registry number for 6-Methoxy-α-methyl-α-(1-methylethyl)-2-naphthalenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(6-methoxynaphthalen-2-yl)-3-methylbutan-2-ol (CAS 1443306-65-7) is a chemical compound with the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. IUPAC name: 2-(6-methoxynaphthalen-2-yl)-3-methylbutan-2-ol. InChIKey: COJZEZPUSAFEMP-UHFFFAOYSA-N.
| Molecular formula | C16H20O2 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | 2-(6-methoxynaphthalen-2-yl)-3-methylbutan-2-ol |
| InChIKey | COJZEZPUSAFEMP-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(C1=CC2=C(C=C1)C=C(C=C2)OC)O |
Computed by PubChem (NCBI)