CAS 1269652-00-7 appears in our catalog under these names: (S)–2–Amino–2–(pyridin–2–yl)ethanol dihydrochloride, (2S)-2-amino-2-(pyridin-2-yl)ethan-1-ol dihydrochloride, 95%, 95%, (S)-2-Amino-2-(pyridin-2-yl)ethanol dihydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-pyridin-2-ylethanol;dihydrochloride (CAS 1269652-00-7) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: (2S)-2-amino-2-pyridin-2-ylethanol;dihydrochloride. InChIKey: CHZFBNDZYOIRDZ-QYCVXMPOSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | (2S)-2-amino-2-pyridin-2-ylethanol;dihydrochloride |
| InChIKey | CHZFBNDZYOIRDZ-QYCVXMPOSA-N |
| SMILES | C1=CC=NC(=C1)[C@@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)