CAS 2097958-04-6 appears in our catalog under these names: (R)-2-Amino-2-(pyridin-2-yl)ethanol dihydrochloride, 98%, 98%, (R)-2-Amino-2-(pyridin-2-yl)ethan-1-ol dihydrochloride, 98%, (R)-2-Amino-2-(pyridin-2-yl)ethanol dihydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg, 10g.
(2R)-2-amino-2-pyridin-2-ylethanol;dihydrochloride (CAS 2097958-04-6) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: (2R)-2-amino-2-pyridin-2-ylethanol;dihydrochloride. InChIKey: CHZFBNDZYOIRDZ-ILKKLZGPSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | (2R)-2-amino-2-pyridin-2-ylethanol;dihydrochloride |
| InChIKey | CHZFBNDZYOIRDZ-ILKKLZGPSA-N |
| SMILES | C1=CC=NC(=C1)[C@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)