CAS 1269757-29-0 appears in our catalog under these names: Trans-1-(benzyloxycarbonyl)-5-methylpiperidine-3-carboxylic acid, 95%, trans-1-((Benzyloxy)carbonyl)-5-methylpiperidine-3-carboxylic acid, 95+%, trans–1–((Benzyloxy)carbonyl)–5–methylpiperidine–3–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
(3S,5S)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 1269757-29-0) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (3S,5S)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: SOYXQVSBDHHRLV-AAEUAGOBSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (3S,5S)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | SOYXQVSBDHHRLV-AAEUAGOBSA-N |
| SMILES | C[C@H]1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)