CAS 1821737-68-1 appears in our catalog under these names: (3S,5R)-1-Benzyloxycarbonyl-5-methyl-piperidine-3-carboxylic acid, 95%, (3S,5r)-1-benzyloxycarbonyl-5-methyl-piperidine-3-carboxylic acid, 97%, 1-(Phenylmethyl) (3S,5R)-5-methyl-1,3-piperidinedicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
(3S,5R)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 1821737-68-1) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (3S,5R)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: SOYXQVSBDHHRLV-YPMHNXCESA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (3S,5R)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | SOYXQVSBDHHRLV-YPMHNXCESA-N |
| SMILES | C[C@@H]1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)