Products 126979-81-5
CAS 126979-81-5 is the registry number for Methylenedihydrotanshinquinone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 1 mg, 5 mg.
(1R)-1-methyl-6-methylidene-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione (CAS 126979-81-5) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 280.3 g/mol. IUPAC name: (1R)-1-methyl-6-methylidene-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione. InChIKey: UXXYCZFYFKWTPQ-JTQLQIEISA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | (1R)-1-methyl-6-methylidene-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| InChIKey | UXXYCZFYFKWTPQ-JTQLQIEISA-N |
| SMILES | C[C@H]1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4=C |
Computed by PubChem (NCBI)
Synonyms:
Methylenedihydrotanshinquinone, orb1990787