CAS 1270141-35-9 is the registry number for H-L-Phe(4-iBu)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-amino-3-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 1270141-35-9) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: (2S)-2-amino-3-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: UOEVBYYIYAIKDF-LBPRGKRZSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | UOEVBYYIYAIKDF-LBPRGKRZSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)