Products 1270153-04-2
CAS 1270153-04-2 appears in our catalog under these names: Melphalan Impurity 2（Melphalan EP Impurity B）, Melphalan EP Impurity B, (2S)-2-Amino-3-(4-morpholin-4-ylphenyl)propanoic Acid, >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg.
(2S)-2-amino-3-(4-morpholin-4-ylphenyl)propanoic acid (CAS 1270153-04-2) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: (2S)-2-amino-3-(4-morpholin-4-ylphenyl)propanoic acid. InChIKey: BKFTZFXJLYAYLN-LBPRGKRZSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-morpholin-4-ylphenyl)propanoic acid |
| InChIKey | BKFTZFXJLYAYLN-LBPRGKRZSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
Melphalan Impurity B, (2S)-2-Amino-3-(4-morpholin-4-ylphenyl)propanoic Acid, Melphalan EP Impurity B, 4-Morpholino-L-phenylalanine, 4-Morpholin-4-yl-L-phenylalanine, L-Phenylalanine, 4-(4-morpholinyl)-, Melphalan impurity B [EP], 4-(4-Morpholinyl)-L-phenylalanine, (S)-2-Amino-3-(4-morpholinophenyl)propanoic acid, 4-(4-Morpholinyl)-L-phenylalanine; Melphalan Impurity B