Products 127017-69-0

CAS 127017-69-0 is the registry number for Paroxetine Hydrochloride Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-methoxyphenyl)piperidine (CAS 127017-69-0) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-methoxyphenyl)piperidine. InChIKey: QAQIPFPQZRXDMA-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23NO4
Molecular weight341.4 g/mol
IUPAC name3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-methoxyphenyl)piperidine
InChIKeyQAQIPFPQZRXDMA-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2CCNCC2COC3=CC4=C(C=C3)OCO4

Computed by PubChem (NCBI)