Products 1270585-70-0
CAS 1270585-70-0 is the registry number for 1-Naphthalenol, 1,2,3,4-tetrahydro-6-(trifluoromethyl)-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 1270585-70-0) is a chemical compound with the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. IUPAC name: 6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: XCBFZUFBBYAXSZ-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | XCBFZUFBBYAXSZ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)