CAS 1270301-29-5 is the registry number for (R)-6-(Difluoromethoxy)-2,3-dihydro-1H-inden-1-ol, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R)-6-(difluoromethoxy)-2,3-dihydro-1H-inden-1-ol (CAS 1270301-29-5) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: (1R)-6-(difluoromethoxy)-2,3-dihydro-1H-inden-1-ol. InChIKey: IQMUSXBHYFARHR-SECBINFHSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | (1R)-6-(difluoromethoxy)-2,3-dihydro-1H-inden-1-ol |
| InChIKey | IQMUSXBHYFARHR-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1O)C=C(C=C2)OC(F)F |
Computed by PubChem (NCBI)