Products 2102409-18-5
CAS 2102409-18-5 is the registry number for (S)-1-(6-(Trifluoromethyl)pyridazin-3-yl)ethan-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[6-(trifluoromethyl)pyridazin-3-yl]ethanamine (CAS 2102409-18-5) is a chemical compound with the molecular formula C7H8F3N3 and a molecular weight of 191.15 g/mol. IUPAC name: (1S)-1-[6-(trifluoromethyl)pyridazin-3-yl]ethanamine. InChIKey: MNWZSVNHYPXSKF-BYPYZUCNSA-N.
| Molecular formula | C7H8F3N3 |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | (1S)-1-[6-(trifluoromethyl)pyridazin-3-yl]ethanamine |
| InChIKey | MNWZSVNHYPXSKF-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1=NN=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)