CAS 1270479-61-2 appears in our catalog under these names: 2,2,2-Trifluoro-1-(4-(trifluoromethoxy)phenyl)ethanamine, 97%, 2,2,2-Trifluoro-1-(4-(trifluoromethoxy)phenyl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine (CAS 1270479-61-2) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine. InChIKey: OXSICALTKBOYQS-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-(trifluoromethoxy)phenyl]ethanamine |
| InChIKey | OXSICALTKBOYQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)OC(F)(F)F |
Computed by PubChem (NCBI)