Products 1270659-75-0

CAS 1270659-75-0 is the registry number for 2-(4-(2-Isopropoxyethyl)piperazin-1-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(2-propan-2-yloxyethyl)piperazin-1-yl]propanoic acid (CAS 1270659-75-0) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: 2-[4-(2-propan-2-yloxyethyl)piperazin-1-yl]propanoic acid. InChIKey: OLXGTGPJPWGCPU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24N2O3
Molecular weight244.33 g/mol
IUPAC name2-[4-(2-propan-2-yloxyethyl)piperazin-1-yl]propanoic acid
InChIKeyOLXGTGPJPWGCPU-UHFFFAOYSA-N
SMILESCC(C)OCCN1CCN(CC1)C(C)C(=O)O

Computed by PubChem (NCBI)