CAS 1270700-85-0 appears in our catalog under these names: 3-Amino-1-(2-(trifluoromethyl)phenyl)pyrrolidin-2-one, 95%, 3-Amino-1-(2-(trifluoromethyl)phenyl)pyrrolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-amino-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one (CAS 1270700-85-0) is a chemical compound with the molecular formula C11H11F3N2O and a molecular weight of 244.21 g/mol. IUPAC name: 3-amino-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one. InChIKey: LHMSGEZKVCWWNW-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 3-amino-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| InChIKey | LHMSGEZKVCWWNW-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1N)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)