CAS 912846-88-9 is the registry number for 1-(6-Amino-3,4-dihydroisoquinolin-2(1H)-yl)-2,2,2-trifluoroethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone (CAS 912846-88-9) is a chemical compound with the molecular formula C11H11F3N2O and a molecular weight of 244.21 g/mol. IUPAC name: 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone. InChIKey: UTDBLNFAKUZGNT-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 1-(6-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | UTDBLNFAKUZGNT-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C=C(C=C2)N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)