Products 467452-24-0
CAS 467452-24-0 appears in our catalog under these names: 2-(5-(Trifluoromethoxy)-1h-indol-3-yl)ethanamine, 95%, 5-(Trifluoromethoxy)-1H-indole-3-ethanamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg.
2-[5-(trifluoromethoxy)-1H-indol-3-yl]ethanamine (CAS 467452-24-0) is a chemical compound with the molecular formula C11H11F3N2O and a molecular weight of 244.21 g/mol. IUPAC name: 2-[5-(trifluoromethoxy)-1H-indol-3-yl]ethanamine. InChIKey: OMDUIRZSXDJSEX-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 2-[5-(trifluoromethoxy)-1H-indol-3-yl]ethanamine |
| InChIKey | OMDUIRZSXDJSEX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)C(=CN2)CCN |
Computed by PubChem (NCBI)