CAS 1803415-70-4 is the registry number for 4,4-Dimethyl-2-(5-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dimethyl-2-[5-(trifluoromethyl)-2-pyridinyl]-5H-1,3-oxazole (CAS 1803415-70-4) is a chemical compound with the molecular formula C11H11F3N2O and a molecular weight of 244.21 g/mol. IUPAC name: 4,4-dimethyl-2-[5-(trifluoromethyl)-2-pyridinyl]-5H-1,3-oxazole. InChIKey: GLRRFOUNOZBVRI-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 4,4-dimethyl-2-[5-(trifluoromethyl)-2-pyridinyl]-5H-1,3-oxazole |
| InChIKey | GLRRFOUNOZBVRI-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=NC=C(C=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)