CAS 53976-98-0 is the registry number for Ethyl 6-isopropyl-4-oxo-1,4-dihydroquinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 4-oxo-6-propan-2-yl-1H-quinoline-3-carboxylate (CAS 53976-98-0) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: ethyl 4-oxo-6-propan-2-yl-1H-quinoline-3-carboxylate. InChIKey: JBFFEVKDAYLOKF-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | ethyl 4-oxo-6-propan-2-yl-1H-quinoline-3-carboxylate |
| InChIKey | JBFFEVKDAYLOKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)C(C)C |
Computed by PubChem (NCBI)