CAS 1270981-54-8 is the registry number for Methyl 4-(difluoromethyl)-2-fluorobenzoate, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Methyl 4-(difluoromethyl)-2-fluorobenzoate (CAS 1270981-54-8) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: methyl 4-(difluoromethyl)-2-fluorobenzoate. InChIKey: TYTJHROFICJJOJ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | methyl 4-(difluoromethyl)-2-fluorobenzoate |
| InChIKey | TYTJHROFICJJOJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(F)F)F |
Computed by PubChem (NCBI)