Products 127184-04-7
CAS 127184-04-7 is the registry number for (1S)-(-)-(7,7-Dichloro-10-camphorsulfonyl)imine. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
6,6-dichloro-10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]dec-4-ene 3,3-dioxide (CAS 127184-04-7) is a chemical compound with the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. IUPAC name: 6,6-dichloro-10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]dec-4-ene 3,3-dioxide. InChIKey: OPVLQNKVOQBPIM-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2S |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | 6,6-dichloro-10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]dec-4-ene 3,3-dioxide |
| InChIKey | OPVLQNKVOQBPIM-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC13CS(=O)(=O)N=C3C2(Cl)Cl)C |
Computed by PubChem (NCBI)