Products 883022-47-7
CAS 883022-47-7 is the registry number for N-(tert-Butyl)-3,4-dichlorobenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-3,4-dichlorobenzenesulfonamide (CAS 883022-47-7) is a chemical compound with the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. IUPAC name: N-tert-butyl-3,4-dichlorobenzenesulfonamide. InChIKey: FOKXARWGNQGGES-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2S |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | N-tert-butyl-3,4-dichlorobenzenesulfonamide |
| InChIKey | FOKXARWGNQGGES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)