Products 1087639-19-7
CAS 1087639-19-7 is the registry number for 3,4-Dichloro-N-isobutylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-N-(2-methylpropyl)benzenesulfonamide (CAS 1087639-19-7) is a chemical compound with the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. IUPAC name: 3,4-dichloro-N-(2-methylpropyl)benzenesulfonamide. InChIKey: UWMXYEHZYFRSQS-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2S |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | 3,4-dichloro-N-(2-methylpropyl)benzenesulfonamide |
| InChIKey | UWMXYEHZYFRSQS-UHFFFAOYSA-N |
| SMILES | CC(C)CNS(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)