CAS 4821-29-8 is the registry number for 2,5-Dichloro-N,N-diethylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-N,N-diethylbenzenesulfonamide (CAS 4821-29-8) is a chemical compound with the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. IUPAC name: 2,5-dichloro-N,N-diethylbenzenesulfonamide. InChIKey: XCGXYDKRIARDGE-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2S |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | 2,5-dichloro-N,N-diethylbenzenesulfonamide |
| InChIKey | XCGXYDKRIARDGE-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)