Products 127199-15-9
CAS 127199-15-9 is the registry number for tert-Butyl ((1S,2R)-2-fluorocyclopropyl)carbamate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S,2R)-2-fluorocyclopropyl]carbamate (CAS 127199-15-9) is a chemical compound with the molecular formula C8H14FNO2 and a molecular weight of 175.20 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-fluorocyclopropyl]carbamate. InChIKey: VWSDKMQGCVVQBV-RITPCOANSA-N.
| Molecular formula | C8H14FNO2 |
|---|---|
| Molecular weight | 175.20 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-fluorocyclopropyl]carbamate |
| InChIKey | VWSDKMQGCVVQBV-RITPCOANSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]1F |
Computed by PubChem (NCBI)