CAS 2361608-79-7 is the registry number for Methyl (1R,3R)-3-(aminomethyl)-3-fluorocyclopentane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-methyl (1R,3R)-3-(aminomethyl)-3-fluorocyclopentane-1-carboxylate (CAS 2361608-79-7) is a chemical compound with the molecular formula C8H14FNO2 and a molecular weight of 175.20 g/mol. IUPAC name: cis-methyl (1R,3R)-3-(aminomethyl)-3-fluorocyclopentane-1-carboxylate. InChIKey: PYSPAVHHWWZRNE-HTRCEHHLSA-N.
| Molecular formula | C8H14FNO2 |
|---|---|
| Molecular weight | 175.20 g/mol |
| IUPAC name | cis-methyl (1R,3R)-3-(aminomethyl)-3-fluorocyclopentane-1-carboxylate |
| InChIKey | PYSPAVHHWWZRNE-HTRCEHHLSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@](C1)(CN)F |
Computed by PubChem (NCBI)