CAS 2637450-21-4 is the registry number for (7S,8R)-7-Fluoro-1,4-dioxaspiro[4.5]decan-8-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(7S,8R)-7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine (CAS 2637450-21-4) is a chemical compound with the molecular formula C8H14FNO2 and a molecular weight of 175.20 g/mol. IUPAC name: (7S,8R)-7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine. InChIKey: NQQAQTHJGLCCRJ-NKWVEPMBSA-N.
| Molecular formula | C8H14FNO2 |
|---|---|
| Molecular weight | 175.20 g/mol |
| IUPAC name | (7S,8R)-7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine |
| InChIKey | NQQAQTHJGLCCRJ-NKWVEPMBSA-N |
| SMILES | C1CC2(C[C@@H]([C@@H]1N)F)OCCO2 |
Computed by PubChem (NCBI)