CAS 2761952-53-6 is the registry number for Rel-methyl 2-((3R,5R)-5-fluoropiperidin-3-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(3R,5R)-5-fluoropiperidin-3-yl]acetate (CAS 2761952-53-6) is a chemical compound with the molecular formula C8H14FNO2 and a molecular weight of 175.20 g/mol. IUPAC name: methyl 2-[(3R,5R)-5-fluoropiperidin-3-yl]acetate. InChIKey: QKLKGDSAPVXGNZ-NKWVEPMBSA-N.
| Molecular formula | C8H14FNO2 |
|---|---|
| Molecular weight | 175.20 g/mol |
| IUPAC name | methyl 2-[(3R,5R)-5-fluoropiperidin-3-yl]acetate |
| InChIKey | QKLKGDSAPVXGNZ-NKWVEPMBSA-N |
| SMILES | COC(=O)C[C@@H]1C[C@H](CNC1)F |
Computed by PubChem (NCBI)