CAS 1272227-03-8 is the registry number for 3-((1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl)amino)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine (CAS 1272227-03-8) is a chemical compound with the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine. InChIKey: AVJCZQAQHWIPEV-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2S |
|---|---|
| Molecular weight | 280.35 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
| InChIKey | AVJCZQAQHWIPEV-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)NC3CCS(=O)(=O)C3)C |
Computed by PubChem (NCBI)