CAS 1948343-56-3 is the registry number for 3-((1-Methyl-1H-pyrazolo[3,4-b]pyridin-4-yl)amino)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothian-3-yl)-1-methylpyrazolo[3,4-b]pyridin-4-amine (CAS 1948343-56-3) is a chemical compound with the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. IUPAC name: N-(1,1-dioxothian-3-yl)-1-methylpyrazolo[3,4-b]pyridin-4-amine. InChIKey: WNSOPUSBMBKZOS-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2S |
|---|---|
| Molecular weight | 280.35 g/mol |
| IUPAC name | N-(1,1-dioxothian-3-yl)-1-methylpyrazolo[3,4-b]pyridin-4-amine |
| InChIKey | WNSOPUSBMBKZOS-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=CC(=C2C=N1)NC3CCCS(=O)(=O)C3 |
Computed by PubChem (NCBI)