CAS 753470-06-3 is the registry number for 4-(Pyridin-4-yl)-3,4,7,8,9,10-hexahydro-6H-(1,2,4,6)thiatriazino(4,3-a)azepine 2,2-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-pyridin-4-yl-4,6,7,8,9,10-hexahydro-3H-[1,2,4,6]thiatriazino[4,3-a]azepine 2,2-dioxide (CAS 753470-06-3) is a chemical compound with the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. IUPAC name: 4-pyridin-4-yl-4,6,7,8,9,10-hexahydro-3H-[1,2,4,6]thiatriazino[4,3-a]azepine 2,2-dioxide. InChIKey: KJRDDULSZCFHRF-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2S |
|---|---|
| Molecular weight | 280.35 g/mol |
| IUPAC name | 4-pyridin-4-yl-4,6,7,8,9,10-hexahydro-3H-[1,2,4,6]thiatriazino[4,3-a]azepine 2,2-dioxide |
| InChIKey | KJRDDULSZCFHRF-UHFFFAOYSA-N |
| SMILES | C1CCC2=NS(=O)(=O)NC(N2CC1)C3=CC=NC=C3 |
Computed by PubChem (NCBI)