CAS 1946346-51-5 is the registry number for 4-(1-Methyl-1H-pyrazolo[3,4-b]pyridin-4-yl)-1,4-thiazepane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1-methylpyrazolo[3,4-b]pyridin-4-yl)-1,4-thiazepane 1,1-dioxide (CAS 1946346-51-5) is a chemical compound with the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. IUPAC name: 4-(1-methylpyrazolo[3,4-b]pyridin-4-yl)-1,4-thiazepane 1,1-dioxide. InChIKey: ZGOKKPBSUFQCKZ-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2S |
|---|---|
| Molecular weight | 280.35 g/mol |
| IUPAC name | 4-(1-methylpyrazolo[3,4-b]pyridin-4-yl)-1,4-thiazepane 1,1-dioxide |
| InChIKey | ZGOKKPBSUFQCKZ-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=CC(=C2C=N1)N3CCCS(=O)(=O)CC3 |
Computed by PubChem (NCBI)