CAS 2287288-13-3 is the registry number for 3-((6-Amino-1H-benzo[d][1,2,3]triazol-1-yl)methyl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1,1-dioxothian-3-yl)methyl]benzotriazol-5-amine (CAS 2287288-13-3) is a chemical compound with the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. IUPAC name: 3-[(1,1-dioxothian-3-yl)methyl]benzotriazol-5-amine. InChIKey: VXJDOXQMUOAWHD-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O2S |
|---|---|
| Molecular weight | 280.35 g/mol |
| IUPAC name | 3-[(1,1-dioxothian-3-yl)methyl]benzotriazol-5-amine |
| InChIKey | VXJDOXQMUOAWHD-UHFFFAOYSA-N |
| SMILES | C1CC(CS(=O)(=O)C1)CN2C3=C(C=CC(=C3)N)N=N2 |
Computed by PubChem (NCBI)