CAS 1272412-69-7 appears in our catalog under these names: 2,9-Dioxa-6-azaspiro[3.5]nonane-6-carboxylic acid tert-butyl ester, 95%, tert-Butyl 2,5-dioxa-8-azaspiro(3.5)nonane-8-carboxylate, 97%, tert–Butyl 2,5–dioxa–8–azaspiro(3·5)nonane–8–carboxylate, tert-Butyl 2,5-dioxa-8-azaspiro[3.5]nonane-8-carboxylate, 97%, 97%, tert-Butyl 2,5-dioxa-8-azaspiro[3.5]nonane-8-carboxylate, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg.
Tert-butyl 2,5-dioxa-8-azaspiro[3.5]nonane-8-carboxylate (CAS 1272412-69-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl 2,5-dioxa-8-azaspiro[3.5]nonane-8-carboxylate. InChIKey: UVTOWHCUNUQTLJ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | tert-butyl 2,5-dioxa-8-azaspiro[3.5]nonane-8-carboxylate |
| InChIKey | UVTOWHCUNUQTLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2(C1)COC2 |
Computed by PubChem (NCBI)