CAS 127264-10-2 appears in our catalog under these names: 6-(2-Bromoethyl)-2,3-dihydro-1,4-benzodioxine, 6-(2-Bromoethyl)-2,3-dihydrobenzo(b)(1,4)dioxine, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
6-(2-bromoethyl)-2,3-dihydro-1,4-benzodioxine (CAS 127264-10-2) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 6-(2-bromoethyl)-2,3-dihydro-1,4-benzodioxine. InChIKey: NGJZILDWYSVWOA-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 6-(2-bromoethyl)-2,3-dihydro-1,4-benzodioxine |
| InChIKey | NGJZILDWYSVWOA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)CCBr |
Computed by PubChem (NCBI)