CAS 1272656-39-9 appears in our catalog under these names: 2-(tert-Butyl) 7-ethyl 2,6-diazaspiro(3.4)octane-2,7-dicarboxylate, 97%, 2–(tert–Butyl) 7–ethyl 2,6–diazaspiro(3·4)octane–2,7–dicarboxylate, 2-(tert-Butyl) 7-ethyl 2,6-diazaspiro[3.4]octane-2,7-dicarboxylate, 97%, 97%, 2-(tert-Butyl) 7-ethyl 2,6-diazaspiro[3.4]octane-2,7-dicarboxylate, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
2-O-tert-butyl 6-O-ethyl 2,7-diazaspiro[3.4]octane-2,6-dicarboxylate (CAS 1272656-39-9) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: 2-O-tert-butyl 6-O-ethyl 2,7-diazaspiro[3.4]octane-2,6-dicarboxylate. InChIKey: SLXLDVSCBKHICP-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-ethyl 2,7-diazaspiro[3.4]octane-2,6-dicarboxylate |
| InChIKey | SLXLDVSCBKHICP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2(CN1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)