CAS 1272755-18-6 appears in our catalog under these names: Methyl D–asparaginate hydrochloride, H-D-Asn-OMe.HCl 98%, D-Asparagine methyl ester hydrochloride, 98%, 98%, D-Asparagine methyl ester hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
Methyl (2R)-2,4-diamino-4-oxobutanoate;hydrochloride (CAS 1272755-18-6) is a chemical compound with the molecular formula C5H11ClN2O3 and a molecular weight of 182.60 g/mol. IUPAC name: methyl (2R)-2,4-diamino-4-oxobutanoate;hydrochloride. InChIKey: QOMQXHIJXUDQSS-AENDTGMFSA-N.
| Molecular formula | C5H11ClN2O3 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | methyl (2R)-2,4-diamino-4-oxobutanoate;hydrochloride |
| InChIKey | QOMQXHIJXUDQSS-AENDTGMFSA-N |
| SMILES | COC(=O)[C@@H](CC(=O)N)N.Cl |
Computed by PubChem (NCBI)