Products 89799-66-6

CAS 89799-66-6 is the registry number for Ethyl 3-amino-3-hydroxyiminopropanoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl (3Z)-3-amino-3-hydroxyiminopropanoate;hydrochloride (CAS 89799-66-6) is a chemical compound with the molecular formula C5H11ClN2O3 and a molecular weight of 182.60 g/mol. IUPAC name: ethyl (3Z)-3-amino-3-hydroxyiminopropanoate;hydrochloride. InChIKey: YWIRXDMFZJDKHP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H11ClN2O3
Molecular weight182.60 g/mol
IUPAC nameethyl (3Z)-3-amino-3-hydroxyiminopropanoate;hydrochloride
InChIKeyYWIRXDMFZJDKHP-UHFFFAOYSA-N
SMILESCCOC(=O)C/C(=N/O)/N.Cl

Computed by PubChem (NCBI)