Products 336182-04-8

CAS 336182-04-8 is the registry number for (S)-3,5-Diamino-5-oxopentanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3S)-3,5-diamino-5-oxopentanoic acid;hydrochloride (CAS 336182-04-8) is a chemical compound with the molecular formula C5H11ClN2O3 and a molecular weight of 182.60 g/mol. IUPAC name: (3S)-3,5-diamino-5-oxopentanoic acid;hydrochloride. InChIKey: MVWPOIZHZQCPQW-DFWYDOINSA-N.

Identity
Molecular formulaC5H11ClN2O3
Molecular weight182.60 g/mol
IUPAC name(3S)-3,5-diamino-5-oxopentanoic acid;hydrochloride
InChIKeyMVWPOIZHZQCPQW-DFWYDOINSA-N
SMILESC([C@@H](CC(=O)O)N)C(=O)N.Cl

Computed by PubChem (NCBI)