CAS 336182-04-8 is the registry number for (S)-3,5-Diamino-5-oxopentanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3,5-diamino-5-oxopentanoic acid;hydrochloride (CAS 336182-04-8) is a chemical compound with the molecular formula C5H11ClN2O3 and a molecular weight of 182.60 g/mol. IUPAC name: (3S)-3,5-diamino-5-oxopentanoic acid;hydrochloride. InChIKey: MVWPOIZHZQCPQW-DFWYDOINSA-N.
| Molecular formula | C5H11ClN2O3 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | (3S)-3,5-diamino-5-oxopentanoic acid;hydrochloride |
| InChIKey | MVWPOIZHZQCPQW-DFWYDOINSA-N |
| SMILES | C([C@@H](CC(=O)O)N)C(=O)N.Cl |
Computed by PubChem (NCBI)